C27H27F4NO5S — CID 126646347
2-[4-[3-[benzyl-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid (PubChem CID 126646347) has the molecular formula C27H27F4NO5S and a molecular weight of 553.57 g/mol. Its IUPAC name is 2-[4-[3-[benzyl-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid.
| Compound Name | 2-[4-[3-[benzyl-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 126646347 |
| Molecular Formula | C27H27F4NO5S |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | 2-[4-[3-[benzyl-[[2-fluoro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid |
| SMILES | CS(=O)(=O)c1cc(OCCCN(Cc2ccccc2)Cc2cccc(C(F)(F)F)c2F)ccc1CC(=O)O |
| InChI | InChI=1S/C27H27F4NO5S/c1-38(35,36)24-16-22(12-11-20(24)15-25(33)34)37-14-6-13-32(17-19-7-3-2-4-8-19)18-21-9-5-10-23(26(21)28)27(29,30)31/h2-5,7-12,16H,6,13-15,17-18H2,1H3,(H,33,34) |
| InChIKey | YBXORBLOYBGRAI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|