C28H29F4NO5S — CID 126646259
2-[4-[3-[2-(4-fluorophenyl)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid (PubChem CID 126646259) has the molecular formula C28H29F4NO5S and a molecular weight of 567.60 g/mol. Its IUPAC name is 2-[4-[3-[2-(4-fluorophenyl)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid.
| Compound Name | 2-[4-[3-[2-(4-fluorophenyl)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid |
|---|---|
| PubChem CID | 126646259 |
| Molecular Formula | C28H29F4NO5S |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 2-[4-[3-[2-(4-fluorophenyl)ethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]acetic acid |
| SMILES | CS(=O)(=O)c1cc(OCCCN(CCc2ccc(F)cc2)Cc2cccc(C(F)(F)F)c2)ccc1CC(=O)O |
| InChI | InChI=1S/C28H29F4NO5S/c1-39(36,37)26-18-25(11-8-22(26)17-27(34)35)38-15-3-13-33(14-12-20-6-9-24(29)10-7-20)19-21-4-2-5-23(16-21)28(30,31)32/h2,4-11,16,18H,3,12-15,17,19H2,1H3,(H,34,35) |
| InChIKey | VNNIUPAOCBMQMJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|