C27H27F4NO5S — CID 137441198
methyl 4-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylbenzoate (PubChem CID 137441198) has the molecular formula C27H27F4NO5S and a molecular weight of 553.57 g/mol. Its IUPAC name is methyl 4-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylbenzoate.
| Compound Name | methyl 4-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 137441198 |
| Molecular Formula | C27H27F4NO5S |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.15 |
| IUPAC Name | methyl 4-[3-[benzyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylbenzoate |
| SMILES | COC(=O)c1c(F)cc(OCCCN(Cc2ccccc2)Cc2cccc(C(F)(F)F)c2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C27H27F4NO5S/c1-36-26(33)25-23(28)15-22(16-24(25)38(2,34)35)37-13-7-12-32(17-19-8-4-3-5-9-19)18-20-10-6-11-21(14-20)27(29,30)31/h3-6,8-11,14-16H,7,12-13,17-18H2,1-2H3 |
| InChIKey | RUAFJFZIUYLYGF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|