C33H33F4NO5S — CID 118224531
[4-[3-[2,2-diphenylethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanol (PubChem CID 118224531) has the molecular formula C33H33F4NO5S and a molecular weight of 631.69 g/mol. Its IUPAC name is [4-[3-[2,2-diphenylethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanol.
| Compound Name | [4-[3-[2,2-diphenylethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanol |
|---|---|
| PubChem CID | 118224531 |
| Molecular Formula | C33H33F4NO5S |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | [4-[3-[2,2-diphenylethyl-[[3-(trifluoromethoxy)phenyl]methyl]amino]propoxy]-2-fluoro-6-methylsulfonylphenyl]methanol |
| SMILES | CS(=O)(=O)c1cc(OCCCN(Cc2cccc(OC(F)(F)F)c2)CC(c2ccccc2)c2ccccc2)cc(F)c1CO |
| InChI | InChI=1S/C33H33F4NO5S/c1-44(40,41)32-20-28(19-31(34)30(32)23-39)42-17-9-16-38(21-24-10-8-15-27(18-24)43-33(35,36)37)22-29(25-11-4-2-5-12-25)26-13-6-3-7-14-26/h2-8,10-15,18-20,29,39H,9,16-17,21-23H2,1H3 |
| InChIKey | VKWYPSYXUQTOLZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|