C27H28F3NO5S — CID 126646161
2-methylsulfonyl-4-[3-[2-phenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]benzoic acid (PubChem CID 126646161) has the molecular formula C27H28F3NO5S and a molecular weight of 535.58 g/mol. Its IUPAC name is 2-methylsulfonyl-4-[3-[2-phenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]benzoic acid.
| Compound Name | 2-methylsulfonyl-4-[3-[2-phenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 126646161 |
| Molecular Formula | C27H28F3NO5S |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 2-methylsulfonyl-4-[3-[2-phenylethyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]benzoic acid |
| SMILES | CS(=O)(=O)c1cc(OCCCN(CCc2ccccc2)Cc2cccc(C(F)(F)F)c2)ccc1C(=O)O |
| InChI | InChI=1S/C27H28F3NO5S/c1-37(34,35)25-18-23(11-12-24(25)26(32)33)36-16-6-14-31(15-13-20-7-3-2-4-8-20)19-21-9-5-10-22(17-21)27(28,29)30/h2-5,7-12,17-18H,6,13-16,19H2,1H3,(H,32,33) |
| InChIKey | FUJVQSQYLQZVHR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|