C30H36F3NO4S — CID 126646004
1-[4-[3-[(2-methyl-2-phenylpropyl)-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol (PubChem CID 126646004) has the molecular formula C30H36F3NO4S and a molecular weight of 563.68 g/mol. Its IUPAC name is 1-[4-[3-[(2-methyl-2-phenylpropyl)-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol.
| Compound Name | 1-[4-[3-[(2-methyl-2-phenylpropyl)-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol |
|---|---|
| PubChem CID | 126646004 |
| Molecular Formula | C30H36F3NO4S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | 1-[4-[3-[(2-methyl-2-phenylpropyl)-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylphenyl]ethanol |
| SMILES | CC(O)c1ccc(OCCCN(Cc2cccc(C(F)(F)F)c2)CC(C)(C)c2ccccc2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C30H36F3NO4S/c1-22(35)27-15-14-26(19-28(27)39(4,36)37)38-17-9-16-34(21-29(2,3)24-11-6-5-7-12-24)20-23-10-8-13-25(18-23)30(31,32)33/h5-8,10-15,18-19,22,35H,9,16-17,20-21H2,1-4H3 |
| InChIKey | DQHFPPSODBIQTK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|