C29H34F3NO4S — CID 126646306
1-[2-methylsulfonyl-4-[3-[2-phenylpropyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]ethanol (PubChem CID 126646306) has the molecular formula C29H34F3NO4S and a molecular weight of 549.66 g/mol. Its IUPAC name is 1-[2-methylsulfonyl-4-[3-[2-phenylpropyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]ethanol.
| Compound Name | 1-[2-methylsulfonyl-4-[3-[2-phenylpropyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 126646306 |
| Molecular Formula | C29H34F3NO4S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 1-[2-methylsulfonyl-4-[3-[2-phenylpropyl-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]ethanol |
| SMILES | CC(O)c1ccc(OCCCN(Cc2cccc(C(F)(F)F)c2)CC(C)c2ccccc2)cc1S(C)(=O)=O |
| InChI | InChI=1S/C29H34F3NO4S/c1-21(24-10-5-4-6-11-24)19-33(20-23-9-7-12-25(17-23)29(30,31)32)15-8-16-37-26-13-14-27(22(2)34)28(18-26)38(3,35)36/h4-7,9-14,17-18,21-22,34H,8,15-16,19-20H2,1-3H3 |
| InChIKey | MSXKDNLFCBYAEJ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|