C32H39ClF3NO3 — CID 142814704
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]acetic acid;2-methylpropane (PubChem CID 142814704) has the molecular formula C32H39ClF3NO3 and a molecular weight of 578.12 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]acetic acid;2-methylpropane.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]acetic acid;2-methylpropane |
|---|---|
| PubChem CID | 142814704 |
| Molecular Formula | C32H39ClF3NO3 |
| Molecular Weight | 578.12 g/mol |
| Exact Mass | 577.26 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]acetic acid;2-methylpropane |
| SMILES | CC(C)C.CC(CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C28H29ClF3NO3.C4H10/c1-20(22-9-3-2-4-10-22)18-33(19-23-11-6-13-25(27(23)29)28(30,31)32)14-7-15-36-24-12-5-8-21(16-24)17-26(34)35;1-4(2)3/h2-6,8-13,16,20H,7,14-15,17-19H2,1H3,(H,34,35);4H,1-3H3 |
| InChIKey | SIMDGXADXRMSRN-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.12 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|