C27H29ClF3NO3S — CID 142814669
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[2-(2H-thiopyran-6-yl)propyl]amino]propoxy]phenyl]acetic acid (PubChem CID 142814669) has the molecular formula C27H29ClF3NO3S and a molecular weight of 540.05 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[2-(2H-thiopyran-6-yl)propyl]amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[2-(2H-thiopyran-6-yl)propyl]amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 142814669 |
| Molecular Formula | C27H29ClF3NO3S |
| Molecular Weight | 540.05 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[2-(2H-thiopyran-6-yl)propyl]amino]propoxy]phenyl]acetic acid |
| SMILES | CC(CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl)C1=CC=CCS1 |
| InChI | InChI=1S/C27H29ClF3NO3S/c1-19(24-11-2-3-14-36-24)17-32(18-21-8-5-10-23(26(21)28)27(29,30)31)12-6-13-35-22-9-4-7-20(15-22)16-25(33)34/h2-5,7-11,15,19H,6,12-14,16-18H2,1H3,(H,33,34) |
| InChIKey | ZFTKXQWMJIFMJJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.05 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|