C38H39ClF3NO5 — CID 162595396
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(4-ethoxy-3-methyl-4-oxo-2,3-diphenylbutyl)amino]propoxy]phenyl]acetic acid (PubChem CID 162595396) has the molecular formula C38H39ClF3NO5 and a molecular weight of 682.18 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(4-ethoxy-3-methyl-4-oxo-2,3-diphenylbutyl)amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(4-ethoxy-3-methyl-4-oxo-2,3-diphenylbutyl)amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 162595396 |
| Molecular Formula | C38H39ClF3NO5 |
| Molecular Weight | 682.18 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(4-ethoxy-3-methyl-4-oxo-2,3-diphenylbutyl)amino]propoxy]phenyl]acetic acid |
| SMILES | CCOC(=O)C(C)(c1ccccc1)C(CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C38H39ClF3NO5/c1-3-47-36(46)37(2,30-17-8-5-9-18-30)33(28-14-6-4-7-15-28)26-43(25-29-16-11-20-32(35(29)39)38(40,41)42)21-12-22-48-31-19-10-13-27(23-31)24-34(44)45/h4-11,13-20,23,33H,3,12,21-22,24-26H2,1-2H3,(H,44,45) |
| InChIKey | AUJOPWQUWPUGHF-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.18 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|