C28H28Cl2F3NO3 — CID 59701421
2-[3-[3-[2-(3-chlorophenyl)propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetic acid (PubChem CID 59701421) has the molecular formula C28H28Cl2F3NO3 and a molecular weight of 554.44 g/mol. Its IUPAC name is 2-[3-[3-[2-(3-chlorophenyl)propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[2-(3-chlorophenyl)propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59701421 |
| Molecular Formula | C28H28Cl2F3NO3 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.14 |
| IUPAC Name | 2-[3-[3-[2-(3-chlorophenyl)propyl-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]acetic acid |
| SMILES | CC(CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C28H28Cl2F3NO3/c1-19(21-7-3-9-23(29)16-21)17-34(18-22-8-4-11-25(27(22)30)28(31,32)33)12-5-13-37-24-10-2-6-20(14-24)15-26(35)36/h2-4,6-11,14,16,19H,5,12-13,15,17-18H2,1H3,(H,35,36) |
| InChIKey | RXJNUMSYBLQFMZ-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|