C26H27ClF3NO3S — CID 59701468
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-thiophen-3-ylpropyl)amino]propoxy]phenyl]acetic acid (PubChem CID 59701468) has the molecular formula C26H27ClF3NO3S and a molecular weight of 526.02 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-thiophen-3-ylpropyl)amino]propoxy]phenyl]acetic acid.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-thiophen-3-ylpropyl)amino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 59701468 |
| Molecular Formula | C26H27ClF3NO3S |
| Molecular Weight | 526.02 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-thiophen-3-ylpropyl)amino]propoxy]phenyl]acetic acid |
| SMILES | CC(CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccsc1 |
| InChI | InChI=1S/C26H27ClF3NO3S/c1-18(21-9-12-35-17-21)15-31(16-20-6-3-8-23(25(20)27)26(28,29)30)10-4-11-34-22-7-2-5-19(13-22)14-24(32)33/h2-3,5-9,12-13,17-18H,4,10-11,14-16H2,1H3,(H,32,33) |
| InChIKey | AWYGWPIDTPHADS-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.02 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|