C35H36ClF3N2O2 — CID 10372017
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-ethylacetamide (PubChem CID 10372017) has the molecular formula C35H36ClF3N2O2 and a molecular weight of 609.13 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-ethylacetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-ethylacetamide |
|---|---|
| PubChem CID | 10372017 |
| Molecular Formula | C35H36ClF3N2O2 |
| Molecular Weight | 609.13 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-ethylacetamide |
| SMILES | CCNC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C35H36ClF3N2O2/c1-2-40-33(42)23-26-12-9-18-30(22-26)43-21-11-20-41(24-29-17-10-19-32(34(29)36)35(37,38)39)25-31(27-13-5-3-6-14-27)28-15-7-4-8-16-28/h3-10,12-19,22,31H,2,11,20-21,23-25H2,1H3,(H,40,42) |
| InChIKey | NZBJBYFAEOMOLK-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.13 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|