C37H40ClF3N2O3 — CID 10009845
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 10009845) has the molecular formula C37H40ClF3N2O3 and a molecular weight of 653.19 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 10009845 |
| Molecular Formula | C37H40ClF3N2O3 |
| Molecular Weight | 653.19 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C37H40ClF3N2O3/c1-27(26-45-2)42-35(44)23-28-12-9-18-32(22-28)46-21-11-20-43(24-31-17-10-19-34(36(31)38)37(39,40)41)25-33(29-13-5-3-6-14-29)30-15-7-4-8-16-30/h3-10,12-19,22,27,33H,11,20-21,23-26H2,1-2H3,(H,42,44) |
| InChIKey | QAERNMYXUAECKG-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.19 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|