C30H35Cl2F3N2O2 — CID 10257699
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[(2S)-2-phenylpropyl]amino]propoxy]phenyl]-N-ethylacetamide;hydrochloride (PubChem CID 10257699) has the molecular formula C30H35Cl2F3N2O2 and a molecular weight of 583.52 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[(2S)-2-phenylpropyl]amino]propoxy]phenyl]-N-ethylacetamide;hydrochloride.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[(2S)-2-phenylpropyl]amino]propoxy]phenyl]-N-ethylacetamide;hydrochloride |
|---|---|
| PubChem CID | 10257699 |
| Molecular Formula | C30H35Cl2F3N2O2 |
| Molecular Weight | 583.52 g/mol |
| Exact Mass | 582.20 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-[(2S)-2-phenylpropyl]amino]propoxy]phenyl]-N-ethylacetamide;hydrochloride |
| SMILES | CCNC(=O)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)C[C@@H](C)c2ccccc2)c1.Cl |
| InChI | InChI=1S/C30H34ClF3N2O2.ClH/c1-3-35-28(37)19-23-10-7-14-26(18-23)38-17-9-16-36(20-22(2)24-11-5-4-6-12-24)21-25-13-8-15-27(29(25)31)30(32,33)34;/h4-8,10-15,18,22H,3,9,16-17,19-21H2,1-2H3,(H,35,37);1H/t22-;/m1./s1 |
| InChIKey | DNOZTEBEJOVWNQ-VZYDHVRKSA-N |
| XLogP | 7.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.52 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|