C28H31ClF3NO2 — CID 69253878
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]ethanol (PubChem CID 69253878) has the molecular formula C28H31ClF3NO2 and a molecular weight of 506.01 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]ethanol.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 69253878 |
| Molecular Formula | C28H31ClF3NO2 |
| Molecular Weight | 506.01 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]phenyl]ethanol |
| SMILES | CC(CN(CCCOc1cccc(CCO)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C28H31ClF3NO2/c1-21(23-9-3-2-4-10-23)19-33(20-24-11-6-13-26(27(24)29)28(30,31)32)15-7-17-35-25-12-5-8-22(18-25)14-16-34/h2-6,8-13,18,21,34H,7,14-17,19-20H2,1H3 |
| InChIKey | XKGLYLLWGYOIGA-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.01 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|