C29H33ClF3NO4S — CID 126646145
2-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]-2-methylsulfonylphenyl]ethanol (PubChem CID 126646145) has the molecular formula C29H33ClF3NO4S and a molecular weight of 584.10 g/mol. Its IUPAC name is 2-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]-2-methylsulfonylphenyl]ethanol.
| Compound Name | 2-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]-2-methylsulfonylphenyl]ethanol |
|---|---|
| PubChem CID | 126646145 |
| Molecular Formula | C29H33ClF3NO4S |
| Molecular Weight | 584.10 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | 2-[4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-phenylpropyl)amino]propoxy]-2-methylsulfonylphenyl]ethanol |
| SMILES | CC(CN(CCCOc1ccc(CCO)c(S(C)(=O)=O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C29H33ClF3NO4S/c1-21(22-8-4-3-5-9-22)19-34(20-24-10-6-11-26(28(24)30)29(31,32)33)15-7-17-38-25-13-12-23(14-16-35)27(18-25)39(2,36)37/h3-6,8-13,18,21,35H,7,14-17,19-20H2,1-2H3 |
| InChIKey | KADZRHYZLITJQS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.10 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|