C29H31ClF3NO4S — CID 126646132
4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-methyl-2-phenylpropyl)amino]propoxy]-2-methylsulfonylbenzaldehyde (PubChem CID 126646132) has the molecular formula C29H31ClF3NO4S and a molecular weight of 582.08 g/mol. Its IUPAC name is 4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-methyl-2-phenylpropyl)amino]propoxy]-2-methylsulfonylbenzaldehyde.
| Compound Name | 4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-methyl-2-phenylpropyl)amino]propoxy]-2-methylsulfonylbenzaldehyde |
|---|---|
| PubChem CID | 126646132 |
| Molecular Formula | C29H31ClF3NO4S |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | 4-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2-methyl-2-phenylpropyl)amino]propoxy]-2-methylsulfonylbenzaldehyde |
| SMILES | CC(C)(CN(CCCOc1ccc(C=O)c(S(C)(=O)=O)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C29H31ClF3NO4S/c1-28(2,23-10-5-4-6-11-23)20-34(18-21-9-7-12-25(27(21)30)29(31,32)33)15-8-16-38-24-14-13-22(19-35)26(17-24)39(3,36)37/h4-7,9-14,17,19H,8,15-16,18,20H2,1-3H3 |
| InChIKey | ZRUABQPLSYAEJC-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|