C29H31F4NO4S — CID 126645790
4-[3-[[2-(4-fluorophenyl)-2-methylpropyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylbenzaldehyde (PubChem CID 126645790) has the molecular formula C29H31F4NO4S and a molecular weight of 565.63 g/mol. Its IUPAC name is 4-[3-[[2-(4-fluorophenyl)-2-methylpropyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylbenzaldehyde.
| Compound Name | 4-[3-[[2-(4-fluorophenyl)-2-methylpropyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylbenzaldehyde |
|---|---|
| PubChem CID | 126645790 |
| Molecular Formula | C29H31F4NO4S |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 4-[3-[[2-(4-fluorophenyl)-2-methylpropyl]-[[3-(trifluoromethyl)phenyl]methyl]amino]propoxy]-2-methylsulfonylbenzaldehyde |
| SMILES | CC(C)(CN(CCCOc1ccc(C=O)c(S(C)(=O)=O)c1)Cc1cccc(C(F)(F)F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H31F4NO4S/c1-28(2,23-9-11-25(30)12-10-23)20-34(18-21-6-4-7-24(16-21)29(31,32)33)14-5-15-38-26-13-8-22(19-35)27(17-26)39(3,36)37/h4,6-13,16-17,19H,5,14-15,18,20H2,1-3H3 |
| InChIKey | XCZSKJWKJAIWGG-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|