C30H35ClF3N3O — CID 69252122
N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-2-phenyl-N-[3-(3-piperazin-1-ylphenoxy)propyl]propan-1-amine (PubChem CID 69252122) has the molecular formula C30H35ClF3N3O and a molecular weight of 546.08 g/mol. Its IUPAC name is N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-2-phenyl-N-[3-(3-piperazin-1-ylphenoxy)propyl]propan-1-amine.
| Compound Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-2-phenyl-N-[3-(3-piperazin-1-ylphenoxy)propyl]propan-1-amine |
|---|---|
| PubChem CID | 69252122 |
| Molecular Formula | C30H35ClF3N3O |
| Molecular Weight | 546.08 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | N-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]-2-phenyl-N-[3-(3-piperazin-1-ylphenoxy)propyl]propan-1-amine |
| SMILES | CC(CN(CCCOc1cccc(N2CCNCC2)c1)Cc1cccc(C(F)(F)F)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C30H35ClF3N3O/c1-23(24-8-3-2-4-9-24)21-36(22-25-10-5-13-28(29(25)31)30(32,33)34)16-7-19-38-27-12-6-11-26(20-27)37-17-14-35-15-18-37/h2-6,8-13,20,23,35H,7,14-19,21-22H2,1H3 |
| InChIKey | WUVADYONCSLFAW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.08 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|