C39H43ClF3N3O3 — CID 10439930
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 10439930) has the molecular formula C39H43ClF3N3O3 and a molecular weight of 694.24 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 10439930 |
| Molecular Formula | C39H43ClF3N3O3 |
| Molecular Weight | 694.24 g/mol |
| Exact Mass | 693.29 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1)NCCN1CCOCC1 |
| InChI | InChI=1S/C39H43ClF3N3O3/c40-38-33(15-8-17-36(38)39(41,42)43)28-46(29-35(31-11-3-1-4-12-31)32-13-5-2-6-14-32)19-9-23-49-34-16-7-10-30(26-34)27-37(47)44-18-20-45-21-24-48-25-22-45/h1-8,10-17,26,35H,9,18-25,27-29H2,(H,44,47) |
| InChIKey | UGJJIIIGYODIIQ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.24 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|