C38H40ClF3N2O3 — CID 10129407
2-[4-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidin-1-yl]acetic acid (PubChem CID 10129407) has the molecular formula C38H40ClF3N2O3 and a molecular weight of 665.20 g/mol. Its IUPAC name is 2-[4-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10129407 |
| Molecular Formula | C38H40ClF3N2O3 |
| Molecular Weight | 665.20 g/mol |
| Exact Mass | 664.27 |
| IUPAC Name | 2-[4-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]piperidin-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCC(c2cccc(OCCCN(Cc3cccc(C(F)(F)F)c3Cl)CC(c3ccccc3)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C38H40ClF3N2O3/c39-37-32(15-8-17-35(37)38(40,41)42)25-44(26-34(29-10-3-1-4-11-29)30-12-5-2-6-13-30)20-9-23-47-33-16-7-14-31(24-33)28-18-21-43(22-19-28)27-36(45)46/h1-8,10-17,24,28,34H,9,18-23,25-27H2,(H,45,46) |
| InChIKey | BYUIEQAFYWDKHB-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.20 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|