C33H31ClF3NO3 — CID 10289895
3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-4-methylbenzoic acid (PubChem CID 10289895) has the molecular formula C33H31ClF3NO3 and a molecular weight of 582.06 g/mol. Its IUPAC name is 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-4-methylbenzoic acid.
| Compound Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 10289895 |
| Molecular Formula | C33H31ClF3NO3 |
| Molecular Weight | 582.06 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1OCCCN(Cc1cccc(C(F)(F)F)c1Cl)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H31ClF3NO3/c1-23-16-17-26(32(39)40)20-30(23)41-19-9-18-38(21-27-14-8-15-29(31(27)34)33(35,36)37)22-28(24-10-4-2-5-11-24)25-12-6-3-7-13-25/h2-8,10-17,20,28H,9,18-19,21-22H2,1H3,(H,39,40) |
| InChIKey | OSQDZIVPLYNVAV-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.06 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|