C34H34Cl2F3NO3 — CID 142814644
1-chloro-2-(1-phenylethyl)benzene;2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-methylamino]propoxy]phenyl]acetic acid (PubChem CID 142814644) has the molecular formula C34H34Cl2F3NO3 and a molecular weight of 632.55 g/mol. Its IUPAC name is 1-chloro-2-(1-phenylethyl)benzene;2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-methylamino]propoxy]phenyl]acetic acid.
| Compound Name | 1-chloro-2-(1-phenylethyl)benzene;2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-methylamino]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 142814644 |
| Molecular Formula | C34H34Cl2F3NO3 |
| Molecular Weight | 632.55 g/mol |
| Exact Mass | 631.19 |
| IUPAC Name | 1-chloro-2-(1-phenylethyl)benzene;2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-methylamino]propoxy]phenyl]acetic acid |
| SMILES | CC(c1ccccc1)c1ccccc1Cl.CN(CCCOc1cccc(CC(=O)O)c1)Cc1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C20H21ClF3NO3.C14H13Cl/c1-25(13-15-6-3-8-17(19(15)21)20(22,23)24)9-4-10-28-16-7-2-5-14(11-16)12-18(26)27;1-11(12-7-3-2-4-8-12)13-9-5-6-10-14(13)15/h2-3,5-8,11H,4,9-10,12-13H2,1H3,(H,26,27);2-11H,1H3 |
| InChIKey | DLXZGAMGLLZSEM-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.55 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|