C37H38Cl2F3NO3 — CID 10129437
6-[3-[3-[[2-(2-chlorophenyl)-2-phenylethyl]-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]hexanoic acid (PubChem CID 10129437) has the molecular formula C37H38Cl2F3NO3 and a molecular weight of 672.62 g/mol. Its IUPAC name is 6-[3-[3-[[2-(2-chlorophenyl)-2-phenylethyl]-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]hexanoic acid.
| Compound Name | 6-[3-[3-[[2-(2-chlorophenyl)-2-phenylethyl]-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]hexanoic acid |
|---|---|
| PubChem CID | 10129437 |
| Molecular Formula | C37H38Cl2F3NO3 |
| Molecular Weight | 672.62 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 6-[3-[3-[[2-(2-chlorophenyl)-2-phenylethyl]-[[2-chloro-3-(trifluoromethyl)phenyl]methyl]amino]propoxy]phenyl]hexanoic acid |
| SMILES | O=C(O)CCCCCc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C37H38Cl2F3NO3/c38-34-20-8-7-18-31(34)32(28-14-4-2-5-15-28)26-43(25-29-16-10-19-33(36(29)39)37(40,41)42)22-11-23-46-30-17-9-13-27(24-30)12-3-1-6-21-35(44)45/h2,4-5,7-10,13-20,24,32H,1,3,6,11-12,21-23,25-26H2,(H,44,45) |
| InChIKey | YNLWRYHGRXVVFO-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.62 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|