C33H33ClF3N5O — CID 162599006
2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N'-diazenylethanimidamide (PubChem CID 162599006) has the molecular formula C33H33ClF3N5O and a molecular weight of 608.11 g/mol. Its IUPAC name is 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N'-diazenylethanimidamide.
| Compound Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N'-diazenylethanimidamide |
|---|---|
| PubChem CID | 162599006 |
| Molecular Formula | C33H33ClF3N5O |
| Molecular Weight | 608.11 g/mol |
| Exact Mass | 607.23 |
| IUPAC Name | 2-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(2,2-diphenylethyl)amino]propoxy]phenyl]-N'-diazenylethanimidamide |
| SMILES | [H]/N=N/N=C(\N)Cc1cccc(OCCCN(Cc2cccc(C(F)(F)F)c2Cl)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C33H33ClF3N5O/c34-32-27(15-8-17-30(32)33(35,36)37)22-42(23-29(25-11-3-1-4-12-25)26-13-5-2-6-14-26)18-9-19-43-28-16-7-10-24(20-28)21-31(38)40-41-39/h1-8,10-17,20,29H,9,18-19,21-23H2,(H3,38,39,40) |
| InChIKey | QWSRKRZDBDHKAE-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.11 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|