C21H19F3N4O4 — CID 87901990
(2,2,2-trifluoroacetyl) 3-methyl-4-[3-[3-[(pyridin-2-ylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]butanoate (PubChem CID 87901990) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-methyl-4-[3-[3-[(pyridin-2-ylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]butanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-methyl-4-[3-[3-[(pyridin-2-ylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]butanoate |
|---|---|
| PubChem CID | 87901990 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-methyl-4-[3-[3-[(pyridin-2-ylamino)methyl]phenyl]-1,2,4-oxadiazol-5-yl]butanoate |
| SMILES | CC(CC(=O)OC(=O)C(F)(F)F)Cc1nc(-c2cccc(CNc3ccccn3)c2)no1 |
| InChI | InChI=1S/C21H19F3N4O4/c1-13(10-18(29)31-20(30)21(22,23)24)9-17-27-19(28-32-17)15-6-4-5-14(11-15)12-26-16-7-2-3-8-25-16/h2-8,11,13H,9-10,12H2,1H3,(H,25,26) |
| InChIKey | XZLAYHFTFHSMKS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|