C20H27F3N4O5 — CID 139998679
(2,2,2-trifluoroacetyl) (2S)-2-[[(2S)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoate (PubChem CID 139998679) has the molecular formula C20H27F3N4O5 and a molecular weight of 460.45 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-[[(2S)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-[[(2S)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 139998679 |
| Molecular Formula | C20H27F3N4O5 |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-[[(2S)-3-methyl-2-[5-(pyridin-2-ylamino)pentanoylamino]butanoyl]amino]propanoate |
| SMILES | CC(C)[C@H](NC(=O)CCCCNc1ccccn1)C(=O)N[C@@H](C)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C20H27F3N4O5/c1-12(2)16(17(29)26-13(3)18(30)32-19(31)20(21,22)23)27-15(28)9-5-7-11-25-14-8-4-6-10-24-14/h4,6,8,10,12-13,16H,5,7,9,11H2,1-3H3,(H,24,25)(H,26,29)(H,27,28)/t13-,16-/m0/s1 |
| InChIKey | WWYCUMQLHGPTRG-BBRMVZONSA-N |
| XLogP | 1.94 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|