C16H22F3N3O3 — CID 659845
ethyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]-2-(pentanoylamino)propanoate (PubChem CID 659845) has the molecular formula C16H22F3N3O3 and a molecular weight of 361.36 g/mol. Its IUPAC name is ethyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]-2-(pentanoylamino)propanoate.
| Compound Name | ethyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]-2-(pentanoylamino)propanoate |
|---|---|
| PubChem CID | 659845 |
| Molecular Formula | C16H22F3N3O3 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | ethyl 3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]-2-(pentanoylamino)propanoate |
| SMILES | CCCCC(=O)NC(Nc1ccc(C)cn1)(C(=O)OCC)C(F)(F)F |
| InChI | InChI=1S/C16H22F3N3O3/c1-4-6-7-13(23)22-15(16(17,18)19,14(24)25-5-2)21-12-9-8-11(3)10-20-12/h8-10H,4-7H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | MFJNKMMXXROLSD-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|