About methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate
methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate (PubChem CID 605295) has the molecular formula C11H12F3N3O3
and a molecular weight of 291.23 g/mol. Its IUPAC name is methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate.
Molecular Properties
| Compound Name | methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate |
| PubChem CID | 605295 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C11H12F3N3O3/c1-7(18)16-10(9(19)20-2,11(12,13)14)17-8-5-3-4-6-15-8/h3-6H,1-2H3,(H,15,17)(H,16,18) |
| InChIKey | KUNWJYSJEOJQBZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate?
The IUPAC name of methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate (CID 605295) is methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate.
What is the SMILES notation for methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate?
The canonical SMILES for methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate is COC(=O)C(NC(C)=O)(Nc1ccccn1)C(F)(F)F.
What is the InChIKey of methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate?
The InChIKey is KUNWJYSJEOJQBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3N3O3/c1-7(18)16-10(9(19)20-2,11(12,13)14)17-8-5-3-4-6-15-8/h3-6H,1-2H3,(H,15,17)(H,16,18).
What are the key properties of methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate?
methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate has a molecular weight of 291.23 g/mol, XLogP of 1.06, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-3,3,3-trifluoro-2-(pyridin-2-ylamino)propanoate is sourced from PubChem (CID 605295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).