C12H14F3N3O3 — CID 609233
methyl 2-acetamido-3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]propanoate (PubChem CID 609233) has the molecular formula C12H14F3N3O3 and a molecular weight of 305.26 g/mol. Its IUPAC name is methyl 2-acetamido-3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]propanoate.
| Compound Name | methyl 2-acetamido-3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]propanoate |
|---|---|
| PubChem CID | 609233 |
| Molecular Formula | C12H14F3N3O3 |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | methyl 2-acetamido-3,3,3-trifluoro-2-[(5-methyl-2-pyridinyl)amino]propanoate |
| SMILES | COC(=O)C(NC(C)=O)(Nc1ccc(C)cn1)C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O3/c1-7-4-5-9(16-6-7)18-11(10(20)21-3,12(13,14)15)17-8(2)19/h4-6H,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | NLHBGCHKKKDCBD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|