C27H44N2OSn — CID 22602741
N-[4-(3-tributylstannylphenoxy)butyl]pyridin-2-amine (PubChem CID 22602741) has the molecular formula C27H44N2OSn and a molecular weight of 531.37 g/mol. Its IUPAC name is N-[4-(3-tributylstannylphenoxy)butyl]pyridin-2-amine.
| Compound Name | N-[4-(3-tributylstannylphenoxy)butyl]pyridin-2-amine |
|---|---|
| PubChem CID | 22602741 |
| Molecular Formula | C27H44N2OSn |
| Molecular Weight | 531.37 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | N-[4-(3-tributylstannylphenoxy)butyl]pyridin-2-amine |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cccc(OCCCCNc2ccccn2)c1 |
| InChI | InChI=1S/C15H17N2O.3C4H9.Sn/c1-2-8-14(9-3-1)18-13-7-6-12-17-15-10-4-5-11-16-15;3*1-3-4-2;/h1-2,4-5,8-11H,6-7,12-13H2,(H,16,17);3*1,3-4H2,2H3; |
| InChIKey | KMSXRTRRDVMJRA-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.37 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|