C21H28ClN3O — CID 110505596
N-[(E)-(2-chloro-4-nonoxyphenyl)methylideneamino]pyridin-2-amine (PubChem CID 110505596) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is N-[(E)-(2-chloro-4-nonoxyphenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(E)-(2-chloro-4-nonoxyphenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 110505596 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[(E)-(2-chloro-4-nonoxyphenyl)methylideneamino]pyridin-2-amine |
| SMILES | CCCCCCCCCOc1ccc(/C=N/Nc2ccccn2)c(Cl)c1 |
| InChI | InChI=1S/C21H28ClN3O/c1-2-3-4-5-6-7-10-15-26-19-13-12-18(20(22)16-19)17-24-25-21-11-8-9-14-23-21/h8-9,11-14,16-17H,2-7,10,15H2,1H3,(H,23,25)/b24-17+ |
| InChIKey | FPQZTOWPTMPYEY-JJIBRWJFSA-N |
| XLogP | 6.31 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|