C19H24N4O4 — CID 110505616
N-[(E)-(4-hexoxy-3-methoxy-5-nitrophenyl)methylideneamino]pyridin-2-amine (PubChem CID 110505616) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is N-[(E)-(4-hexoxy-3-methoxy-5-nitrophenyl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(E)-(4-hexoxy-3-methoxy-5-nitrophenyl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 110505616 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N-[(E)-(4-hexoxy-3-methoxy-5-nitrophenyl)methylideneamino]pyridin-2-amine |
| SMILES | CCCCCCOc1c(OC)cc(/C=N/Nc2ccccn2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N4O4/c1-3-4-5-8-11-27-19-16(23(24)25)12-15(13-17(19)26-2)14-21-22-18-9-6-7-10-20-18/h6-7,9-10,12-14H,3-5,8,11H2,1-2H3,(H,20,22)/b21-14+ |
| InChIKey | DSRSJUICTXQHNI-KGENOOAVSA-N |
| XLogP | 4.40 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|