C17H22N6O5 — CID 110510031
5-[(2E)-2-[(4-hexoxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one (PubChem CID 110510031) has the molecular formula C17H22N6O5 and a molecular weight of 390.40 g/mol. Its IUPAC name is 5-[(2E)-2-[(4-hexoxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one.
| Compound Name | 5-[(2E)-2-[(4-hexoxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
|---|---|
| PubChem CID | 110510031 |
| Molecular Formula | C17H22N6O5 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 5-[(2E)-2-[(4-hexoxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-2H-1,2,4-triazin-3-one |
| SMILES | CCCCCCOc1c(OC)cc(/C=N/Nc2cn[nH]c(=O)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N6O5/c1-3-4-5-6-7-28-16-13(23(25)26)8-12(9-14(16)27-2)10-18-21-15-11-19-22-17(24)20-15/h8-11H,3-7H2,1-2H3,(H2,20,21,22,24)/b18-10+ |
| InChIKey | TXRCATNAQBPUJV-VCHYOVAHSA-N |
| XLogP | 2.49 |
| TPSA | 144.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|