C12H15N7O4 — CID 5163998
N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-2H-tetrazol-5-amine (PubChem CID 5163998) has the molecular formula C12H15N7O4 and a molecular weight of 321.30 g/mol. Its IUPAC name is N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 5163998 |
| Molecular Formula | C12H15N7O4 |
| Molecular Weight | 321.30 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[(3-methoxy-5-nitro-4-propoxyphenyl)methylideneamino]-2H-tetrazol-5-amine |
| SMILES | CCCOc1c(OC)cc(C=NNc2nn[nH]n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15N7O4/c1-3-4-23-11-9(19(20)21)5-8(6-10(11)22-2)7-13-14-12-15-17-18-16-12/h5-7H,3-4H2,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | VKTNZCANDSVLDS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|