C24H24F3N5O8S — CID 86754336
(2S)-2-(benzenesulfonamido)-3-[[4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 86754336) has the molecular formula C24H24F3N5O8S and a molecular weight of 599.54 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[[4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[[4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86754336 |
| Molecular Formula | C24H24F3N5O8S |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[[4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(NC[C@H](NS(=O)(=O)c1ccccc1)C(=O)O)c1ccc(OCCNc2ncccn2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H23N5O6S.C2HF3O2/c28-20(26-15-19(21(29)30)27-34(31,32)18-5-2-1-3-6-18)16-7-9-17(10-8-16)33-14-13-25-22-23-11-4-12-24-22;3-2(4,5)1(6)7/h1-12,19,27H,13-15H2,(H,26,28)(H,29,30)(H,23,24,25);(H,6,7)/t19-;/m0./s1 |
| InChIKey | QCRFLNDWQGSNKE-FYZYNONXSA-N |
| XLogP | 1.76 |
| TPSA | 196.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|