C22H29N5O7 — CID 10288753
(2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid (PubChem CID 10288753) has the molecular formula C22H29N5O7 and a molecular weight of 475.50 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10288753 |
| Molecular Formula | C22H29N5O7 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (2S)-2-(2,2-dimethylpropoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)COC(=O)N[C@@H](CNC(=O)c1ccc(OCCNc2ncccn2)cc1O)C(=O)O |
| InChI | InChI=1S/C22H29N5O7/c1-22(2,3)13-34-21(32)27-16(19(30)31)12-26-18(29)15-6-5-14(11-17(15)28)33-10-9-25-20-23-7-4-8-24-20/h4-8,11,16,28H,9-10,12-13H2,1-3H3,(H,26,29)(H,27,32)(H,30,31)(H,23,24,25)/t16-/m0/s1 |
| InChIKey | MTBVZAGSEJVINU-INIZCTEOSA-N |
| XLogP | 1.63 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|