C22H30N6O6 — CID 70073451
(2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(pentylcarbamoylamino)propanoic acid (PubChem CID 70073451) has the molecular formula C22H30N6O6 and a molecular weight of 474.52 g/mol. Its IUPAC name is (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(pentylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(pentylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 70073451 |
| Molecular Formula | C22H30N6O6 |
| Molecular Weight | 474.52 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(pentylcarbamoylamino)propanoic acid |
| SMILES | CCCCCNC(=O)N[C@@H](CNC(=O)c1ccc(OCCNc2ncccn2)cc1O)C(=O)O |
| InChI | InChI=1S/C22H30N6O6/c1-2-3-4-8-26-22(33)28-17(20(31)32)14-27-19(30)16-7-6-15(13-18(16)29)34-12-11-25-21-23-9-5-10-24-21/h5-7,9-10,13,17,29H,2-4,8,11-12,14H2,1H3,(H,27,30)(H,31,32)(H,23,24,25)(H2,26,28,33)/t17-/m0/s1 |
| InChIKey | MUGHMFWMXOLLTR-KRWDZBQOSA-N |
| XLogP | 1.35 |
| TPSA | 174.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.52 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|