C20H28N6O6 — CID 10288314
(2S)-3-[[2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(prop-2-enylcarbamoylamino)propanoic acid (PubChem CID 10288314) has the molecular formula C20H28N6O6 and a molecular weight of 448.48 g/mol. Its IUPAC name is (2S)-3-[[2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(prop-2-enylcarbamoylamino)propanoic acid.
| Compound Name | (2S)-3-[[2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(prop-2-enylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 10288314 |
| Molecular Formula | C20H28N6O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (2S)-3-[[2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(prop-2-enylcarbamoylamino)propanoic acid |
| SMILES | C=CCNC(=O)N[C@@H](CNC(=O)c1ccc(OCCNC2=NCCCN2)cc1O)C(=O)O |
| InChI | InChI=1S/C20H28N6O6/c1-2-6-24-20(31)26-15(18(29)30)12-25-17(28)14-5-4-13(11-16(14)27)32-10-9-23-19-21-7-3-8-22-19/h2,4-5,11,15,27H,1,3,6-10,12H2,(H,25,28)(H,29,30)(H2,21,22,23)(H2,24,26,31)/t15-/m0/s1 |
| InChIKey | VKXLKUKOEGRRFI-HNNXBMFYSA-N |
| XLogP | -0.62 |
| TPSA | 173.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|