C33H34N6O7 — CID 57283942
3-[[4-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-2,2-bis(3-phenylprop-2-enoylamino)propanoic acid (PubChem CID 57283942) has the molecular formula C33H34N6O7 and a molecular weight of 626.67 g/mol. Its IUPAC name is 3-[[4-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-2,2-bis(3-phenylprop-2-enoylamino)propanoic acid.
| Compound Name | 3-[[4-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-2,2-bis(3-phenylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 57283942 |
| Molecular Formula | C33H34N6O7 |
| Molecular Weight | 626.67 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 3-[[4-[2-(4,5-dihydro-1H-imidazol-2-ylamino)ethoxy]-2-hydroxybenzoyl]amino]-2,2-bis(3-phenylprop-2-enoylamino)propanoic acid |
| SMILES | O=C(C=Cc1ccccc1)NC(CNC(=O)c1ccc(OCCNC2=NCCN2)cc1O)(NC(=O)C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C33H34N6O7/c40-27-21-25(46-20-19-36-32-34-17-18-35-32)13-14-26(27)30(43)37-22-33(31(44)45,38-28(41)15-11-23-7-3-1-4-8-23)39-29(42)16-12-24-9-5-2-6-10-24/h1-16,21,40H,17-20,22H2,(H,37,43)(H,38,41)(H,39,42)(H,44,45)(H2,34,35,36) |
| InChIKey | REBFVOCAWPWORJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 190.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|