C15H23N3O4 — CID 142022526
ethane;2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoic acid (PubChem CID 142022526) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is ethane;2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoic acid.
| Compound Name | ethane;2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 142022526 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | ethane;2-hydroxy-4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoic acid |
| SMILES | CC.O=C(O)c1ccc(OCCNC2=NCCCN2)cc1O |
| InChI | InChI=1S/C13H17N3O4.C2H6/c17-11-8-9(2-3-10(11)12(18)19)20-7-6-16-13-14-4-1-5-15-13;1-2/h2-3,8,17H,1,4-7H2,(H,18,19)(H2,14,15,16);1-2H3 |
| InChIKey | JGXLCZVQYKRGPY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|