C17H24N4O4 — CID 59042636
(2R)-2-methyl-3-[[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid (PubChem CID 59042636) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2R)-2-methyl-3-[[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid.
| Compound Name | (2R)-2-methyl-3-[[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 59042636 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R)-2-methyl-3-[[4-[2-(1,4,5,6-tetrahydropyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
| SMILES | C[C@H](CNC(=O)c1ccc(OCCNC2=NCCCN2)cc1)C(=O)O |
| InChI | InChI=1S/C17H24N4O4/c1-12(16(23)24)11-21-15(22)13-3-5-14(6-4-13)25-10-9-20-17-18-7-2-8-19-17/h3-6,12H,2,7-11H2,1H3,(H,21,22)(H,23,24)(H2,18,19,20)/t12-/m1/s1 |
| InChIKey | ZLZVTXNYTYOBRV-GFCCVEGCSA-N |
| XLogP | 0.45 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|