C22H25N5O6 — CID 91439182
(2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(3-phenylprop-2-enoylamino)propanoic acid (PubChem CID 91439182) has the molecular formula C22H25N5O6 and a molecular weight of 455.47 g/mol. Its IUPAC name is (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(3-phenylprop-2-enoylamino)propanoic acid.
| Compound Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(3-phenylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 91439182 |
| Molecular Formula | C22H25N5O6 |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(3-phenylprop-2-enoylamino)propanoic acid |
| SMILES | NC(N)=NCCOc1ccc(C(=O)NC[C@H](NC(=O)C=Cc2ccccc2)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C22H25N5O6/c23-22(24)25-10-11-33-15-7-8-16(18(28)12-15)20(30)26-13-17(21(31)32)27-19(29)9-6-14-4-2-1-3-5-14/h1-9,12,17,28H,10-11,13H2,(H,26,30)(H,27,29)(H,31,32)(H4,23,24,25)/t17-/m0/s1 |
| InChIKey | JVLXTNAPDWLZLQ-KRWDZBQOSA-N |
| XLogP | 0.06 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|