C19H29N5O6 — CID 57252421
(2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(hexanoylamino)propanoic acid (PubChem CID 57252421) has the molecular formula C19H29N5O6 and a molecular weight of 423.47 g/mol. Its IUPAC name is (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(hexanoylamino)propanoic acid.
| Compound Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(hexanoylamino)propanoic acid |
|---|---|
| PubChem CID | 57252421 |
| Molecular Formula | C19H29N5O6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | (2S)-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]-2-(hexanoylamino)propanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](CNC(=O)c1ccc(OCCN=C(N)N)cc1O)C(=O)O |
| InChI | InChI=1S/C19H29N5O6/c1-2-3-4-5-16(26)24-14(18(28)29)11-23-17(27)13-7-6-12(10-15(13)25)30-9-8-22-19(20)21/h6-7,10,14,25H,2-5,8-9,11H2,1H3,(H,23,27)(H,24,26)(H,28,29)(H4,20,21,22)/t14-/m0/s1 |
| InChIKey | VZISVKUAPDDSHU-AWEZNQCLSA-N |
| XLogP | -0.08 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|