C18H25NO6 — CID 22861958
(2S)-2-(hexanoylamino)-5-(4-hydroxyphenoxy)-4-methyl-5-oxopentanoic acid (PubChem CID 22861958) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is (2S)-2-(hexanoylamino)-5-(4-hydroxyphenoxy)-4-methyl-5-oxopentanoic acid.
| Compound Name | (2S)-2-(hexanoylamino)-5-(4-hydroxyphenoxy)-4-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 22861958 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | (2S)-2-(hexanoylamino)-5-(4-hydroxyphenoxy)-4-methyl-5-oxopentanoic acid |
| SMILES | CCCCCC(=O)N[C@@H](CC(C)C(=O)Oc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H25NO6/c1-3-4-5-6-16(21)19-15(17(22)23)11-12(2)18(24)25-14-9-7-13(20)8-10-14/h7-10,12,15,20H,3-6,11H2,1-2H3,(H,19,21)(H,22,23)/t12?,15-/m0/s1 |
| InChIKey | NMDDGXHZLIIHLW-CVRLYYSRSA-N |
| XLogP | 2.47 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|