C25H35N5O7 — CID 10289360
(2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(octoxycarbonylamino)propanoic acid (PubChem CID 10289360) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(octoxycarbonylamino)propanoic acid.
| Compound Name | (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(octoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 10289360 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2S)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]-2-(octoxycarbonylamino)propanoic acid |
| SMILES | CCCCCCCCOC(=O)N[C@@H](CNC(=O)c1ccc(OCCNc2ncccn2)cc1O)C(=O)O |
| InChI | InChI=1S/C25H35N5O7/c1-2-3-4-5-6-7-14-37-25(35)30-20(23(33)34)17-29-22(32)19-10-9-18(16-21(19)31)36-15-13-28-24-26-11-8-12-27-24/h8-12,16,20,31H,2-7,13-15,17H2,1H3,(H,29,32)(H,30,35)(H,33,34)(H,26,27,28)/t20-/m0/s1 |
| InChIKey | LWCLQQVXOGAQML-FQEVSTJZSA-N |
| XLogP | 2.94 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|