C20H22BrN5O6 — CID 57040700
(2S)-2-[(2-bromobenzoyl)amino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid (PubChem CID 57040700) has the molecular formula C20H22BrN5O6 and a molecular weight of 508.33 g/mol. Its IUPAC name is (2S)-2-[(2-bromobenzoyl)amino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[(2-bromobenzoyl)amino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 57040700 |
| Molecular Formula | C20H22BrN5O6 |
| Molecular Weight | 508.33 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | (2S)-2-[(2-bromobenzoyl)amino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid |
| SMILES | NC(N)=NCCOc1ccc(C(=O)NC[C@H](NC(=O)c2ccccc2Br)C(=O)O)c(O)c1 |
| InChI | InChI=1S/C20H22BrN5O6/c21-14-4-2-1-3-12(14)18(29)26-15(19(30)31)10-25-17(28)13-6-5-11(9-16(13)27)32-8-7-24-20(22)23/h1-6,9,15,27H,7-8,10H2,(H,25,28)(H,26,29)(H,30,31)(H4,22,23,24)/t15-/m0/s1 |
| InChIKey | HAQYXXOUKOSXMS-HNNXBMFYSA-N |
| XLogP | 0.42 |
| TPSA | 189.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|