C22H26N6O7 — CID 57137911
(2S)-2-[(4-acetylphenyl)carbamoylamino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid (PubChem CID 57137911) has the molecular formula C22H26N6O7 and a molecular weight of 486.49 g/mol. Its IUPAC name is (2S)-2-[(4-acetylphenyl)carbamoylamino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[(4-acetylphenyl)carbamoylamino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 57137911 |
| Molecular Formula | C22H26N6O7 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | (2S)-2-[(4-acetylphenyl)carbamoylamino]-3-[[4-[2-(diaminomethylideneamino)ethoxy]-2-hydroxybenzoyl]amino]propanoic acid |
| SMILES | CC(=O)c1ccc(NC(=O)N[C@@H](CNC(=O)c2ccc(OCCN=C(N)N)cc2O)C(=O)O)cc1 |
| InChI | InChI=1S/C22H26N6O7/c1-12(29)13-2-4-14(5-3-13)27-22(34)28-17(20(32)33)11-26-19(31)16-7-6-15(10-18(16)30)35-9-8-25-21(23)24/h2-7,10,17,30H,8-9,11H2,1H3,(H,26,31)(H,32,33)(H4,23,24,25)(H2,27,28,34)/t17-/m0/s1 |
| InChIKey | HWBTUXOVWRVQAV-KRWDZBQOSA-N |
| XLogP | 0.25 |
| TPSA | 218.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|