C21H25N5O7 — CID 10173873
(2S)-2-(but-3-enoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid (PubChem CID 10173873) has the molecular formula C21H25N5O7 and a molecular weight of 459.46 g/mol. Its IUPAC name is (2S)-2-(but-3-enoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-(but-3-enoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10173873 |
| Molecular Formula | C21H25N5O7 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (2S)-2-(but-3-enoxycarbonylamino)-3-[[2-hydroxy-4-[2-(pyrimidin-2-ylamino)ethoxy]benzoyl]amino]propanoic acid |
| SMILES | C=CCCOC(=O)N[C@@H](CNC(=O)c1ccc(OCCNc2ncccn2)cc1O)C(=O)O |
| InChI | InChI=1S/C21H25N5O7/c1-2-3-10-33-21(31)26-16(19(29)30)13-25-18(28)15-6-5-14(12-17(15)27)32-11-9-24-20-22-7-4-8-23-20/h2,4-8,12,16,27H,1,3,9-11,13H2,(H,25,28)(H,26,31)(H,29,30)(H,22,23,24)/t16-/m0/s1 |
| InChIKey | VSJFZJKIUHJGOM-INIZCTEOSA-N |
| XLogP | 1.16 |
| TPSA | 172.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|